C15H16BrN3O3 — CID 78379150
4-(6-bromo-2,4-dioxo-4aH-quinazolin-3-yl)-N-prop-2-enylbutanamide (PubChem CID 78379150) has the molecular formula C15H16BrN3O3 and a molecular weight of 366.22 g/mol. Its IUPAC name is 4-(6-bromo-2,4-dioxo-4aH-quinazolin-3-yl)-N-prop-2-enylbutanamide.
| Compound Name | 4-(6-bromo-2,4-dioxo-4aH-quinazolin-3-yl)-N-prop-2-enylbutanamide |
|---|---|
| PubChem CID | 78379150 |
| Molecular Formula | C15H16BrN3O3 |
| Molecular Weight | 366.22 g/mol |
| Exact Mass | 365.04 |
| IUPAC Name | 4-(6-bromo-2,4-dioxo-4aH-quinazolin-3-yl)-N-prop-2-enylbutanamide |
| SMILES | C=CCNC(=O)CCCN1C(=O)N=C2C=CC(Br)=CC2C1=O |
| InChI | InChI=1S/C15H16BrN3O3/c1-2-7-17-13(20)4-3-8-19-14(21)11-9-10(16)5-6-12(11)18-15(19)22/h2,5-6,9,11H,1,3-4,7-8H2,(H,17,20) |
| InChIKey | CZBIOZSKXGRKKN-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.22 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|