C17H21N3O3 — CID 78326031
6-(2,4-dioxo-4aH-quinazolin-3-yl)-N-prop-2-enylhexanamide (PubChem CID 78326031) has the molecular formula C17H21N3O3 and a molecular weight of 315.37 g/mol. Its IUPAC name is 6-(2,4-dioxo-4aH-quinazolin-3-yl)-N-prop-2-enylhexanamide.
| Compound Name | 6-(2,4-dioxo-4aH-quinazolin-3-yl)-N-prop-2-enylhexanamide |
|---|---|
| PubChem CID | 78326031 |
| Molecular Formula | C17H21N3O3 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | 6-(2,4-dioxo-4aH-quinazolin-3-yl)-N-prop-2-enylhexanamide |
| SMILES | C=CCNC(=O)CCCCCN1C(=O)N=C2C=CC=CC2C1=O |
| InChI | InChI=1S/C17H21N3O3/c1-2-11-18-15(21)10-4-3-7-12-20-16(22)13-8-5-6-9-14(13)19-17(20)23/h2,5-6,8-9,13H,1,3-4,7,10-12H2,(H,18,21) |
| InChIKey | CGLXQCVOOIZLFN-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|