C18H25N3O3 — CID 78341563
N-butyl-6-(2,4-dioxo-4aH-quinazolin-3-yl)hexanamide (PubChem CID 78341563) has the molecular formula C18H25N3O3 and a molecular weight of 331.42 g/mol. Its IUPAC name is N-butyl-6-(2,4-dioxo-4aH-quinazolin-3-yl)hexanamide.
| Compound Name | N-butyl-6-(2,4-dioxo-4aH-quinazolin-3-yl)hexanamide |
|---|---|
| PubChem CID | 78341563 |
| Molecular Formula | C18H25N3O3 |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.19 |
| IUPAC Name | N-butyl-6-(2,4-dioxo-4aH-quinazolin-3-yl)hexanamide |
| SMILES | CCCCNC(=O)CCCCCN1C(=O)N=C2C=CC=CC2C1=O |
| InChI | InChI=1S/C18H25N3O3/c1-2-3-12-19-16(22)11-5-4-8-13-21-17(23)14-9-6-7-10-15(14)20-18(21)24/h6-7,9-10,14H,2-5,8,11-13H2,1H3,(H,19,22) |
| InChIKey | MFWWTCQKQRQHEM-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|