C24H25BrN4O2S — CID 78340557
6-(6-bromo-4-oxo-2-sulfanylidene-4aH-quinazolin-3-yl)-N-[2-(1H-indol-3-yl)ethyl]hexanamide (PubChem CID 78340557) has the molecular formula C24H25BrN4O2S and a molecular weight of 513.46 g/mol. Its IUPAC name is 6-(6-bromo-4-oxo-2-sulfanylidene-4aH-quinazolin-3-yl)-N-[2-(1H-indol-3-yl)ethyl]hexanamide.
| Compound Name | 6-(6-bromo-4-oxo-2-sulfanylidene-4aH-quinazolin-3-yl)-N-[2-(1H-indol-3-yl)ethyl]hexanamide |
|---|---|
| PubChem CID | 78340557 |
| Molecular Formula | C24H25BrN4O2S |
| Molecular Weight | 513.46 g/mol |
| Exact Mass | 512.09 |
| IUPAC Name | 6-(6-bromo-4-oxo-2-sulfanylidene-4aH-quinazolin-3-yl)-N-[2-(1H-indol-3-yl)ethyl]hexanamide |
| SMILES | O=C(CCCCCN1C(=O)C2C=C(Br)C=CC2=NC1=S)NCCc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C24H25BrN4O2S/c25-17-9-10-21-19(14-17)23(31)29(24(32)28-21)13-5-1-2-8-22(30)26-12-11-16-15-27-20-7-4-3-6-18(16)20/h3-4,6-7,9-10,14-15,19,27H,1-2,5,8,11-13H2,(H,26,30) |
| InChIKey | ZWTZKCRUQFKCFV-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 77.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.46 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|