C19H17BrClN3O2S — CID 78316915
4-(6-bromo-4-oxo-2-sulfanylidene-4aH-quinazolin-3-yl)-N-[(3-chlorophenyl)methyl]butanamide (PubChem CID 78316915) has the molecular formula C19H17BrClN3O2S and a molecular weight of 466.79 g/mol. Its IUPAC name is 4-(6-bromo-4-oxo-2-sulfanylidene-4aH-quinazolin-3-yl)-N-[(3-chlorophenyl)methyl]butanamide.
| Compound Name | 4-(6-bromo-4-oxo-2-sulfanylidene-4aH-quinazolin-3-yl)-N-[(3-chlorophenyl)methyl]butanamide |
|---|---|
| PubChem CID | 78316915 |
| Molecular Formula | C19H17BrClN3O2S |
| Molecular Weight | 466.79 g/mol |
| Exact Mass | 464.99 |
| IUPAC Name | 4-(6-bromo-4-oxo-2-sulfanylidene-4aH-quinazolin-3-yl)-N-[(3-chlorophenyl)methyl]butanamide |
| SMILES | O=C(CCCN1C(=O)C2C=C(Br)C=CC2=NC1=S)NCc1cccc(Cl)c1 |
| InChI | InChI=1S/C19H17BrClN3O2S/c20-13-6-7-16-15(10-13)18(26)24(19(27)23-16)8-2-5-17(25)22-11-12-3-1-4-14(21)9-12/h1,3-4,6-7,9-10,15H,2,5,8,11H2,(H,22,25) |
| InChIKey | HSJMBELYZZPHPZ-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.79 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|