C20H21ClFN5O2S — CID 74535170
2-[[1-(4-chlorophenyl)-4-oxo-3,3a,5,6,7,7a-hexahydro-2H-pyrazolo[3,4-d]pyrimidin-6-yl]sulfanyl]-N-[(4-fluorophenyl)methyl]acetamide (PubChem CID 74535170) has the molecular formula C20H21ClFN5O2S and a molecular weight of 449.94 g/mol. Its IUPAC name is 2-[[1-(4-chlorophenyl)-4-oxo-3,3a,5,6,7,7a-hexahydro-2H-pyrazolo[3,4-d]pyrimidin-6-yl]sulfanyl]-N-[(4-fluorophenyl)methyl]acetamide.
| Compound Name | 2-[[1-(4-chlorophenyl)-4-oxo-3,3a,5,6,7,7a-hexahydro-2H-pyrazolo[3,4-d]pyrimidin-6-yl]sulfanyl]-N-[(4-fluorophenyl)methyl]acetamide |
|---|---|
| PubChem CID | 74535170 |
| Molecular Formula | C20H21ClFN5O2S |
| Molecular Weight | 449.94 g/mol |
| Exact Mass | 449.11 |
| IUPAC Name | 2-[[1-(4-chlorophenyl)-4-oxo-3,3a,5,6,7,7a-hexahydro-2H-pyrazolo[3,4-d]pyrimidin-6-yl]sulfanyl]-N-[(4-fluorophenyl)methyl]acetamide |
| SMILES | O=C(CSC1NC(=O)C2CNN(c3ccc(Cl)cc3)C2N1)NCc1ccc(F)cc1 |
| InChI | InChI=1S/C20H21ClFN5O2S/c21-13-3-7-15(8-4-13)27-18-16(10-24-27)19(29)26-20(25-18)30-11-17(28)23-9-12-1-5-14(22)6-2-12/h1-8,16,18,20,24-25H,9-11H2,(H,23,28)(H,26,29) |
| InChIKey | AQTKZQWDUPGFPM-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 85.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.94 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |