C16H18Cl2N2O2 — CID 74539659
3,3-dichloro-1-[4-(2-oxopiperidin-1-yl)phenyl]piperidin-2-one (PubChem CID 74539659) has the molecular formula C16H18Cl2N2O2 and a molecular weight of 341.24 g/mol. Its IUPAC name is 3,3-dichloro-1-[4-(2-oxopiperidin-1-yl)phenyl]piperidin-2-one.
| Compound Name | 3,3-dichloro-1-[4-(2-oxopiperidin-1-yl)phenyl]piperidin-2-one |
|---|---|
| PubChem CID | 74539659 |
| Molecular Formula | C16H18Cl2N2O2 |
| Molecular Weight | 341.24 g/mol |
| Exact Mass | 340.07 |
| IUPAC Name | 3,3-dichloro-1-[4-(2-oxopiperidin-1-yl)phenyl]piperidin-2-one |
| SMILES | O=C1CCCCN1c1ccc(N2CCCC(Cl)(Cl)C2=O)cc1 |
| InChI | InChI=1S/C16H18Cl2N2O2/c17-16(18)9-3-11-20(15(16)22)13-7-5-12(6-8-13)19-10-2-1-4-14(19)21/h5-8H,1-4,9-11H2 |
| InChIKey | HSUUUSVMDGEUTE-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.24 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|