C11H10Cl3NO — CID 134094956
3,3-dichloro-1-(4-chlorophenyl)piperidin-2-one (PubChem CID 134094956) has the molecular formula C11H10Cl3NO and a molecular weight of 278.57 g/mol. Its IUPAC name is 3,3-dichloro-1-(4-chlorophenyl)piperidin-2-one.
| Compound Name | 3,3-dichloro-1-(4-chlorophenyl)piperidin-2-one |
|---|---|
| PubChem CID | 134094956 |
| Molecular Formula | C11H10Cl3NO |
| Molecular Weight | 278.57 g/mol |
| Exact Mass | 276.98 |
| IUPAC Name | 3,3-dichloro-1-(4-chlorophenyl)piperidin-2-one |
| SMILES | O=C1N(c2ccc(Cl)cc2)CCCC1(Cl)Cl |
| InChI | InChI=1S/C11H10Cl3NO/c12-8-2-4-9(5-3-8)15-7-1-6-11(13,14)10(15)16/h2-5H,1,6-7H2 |
| InChIKey | AULNIMFFXXPGPJ-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.57 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|