C13H12ClNO3 — CID 171779142
7-(4-chlorophenyl)-2-oxa-7-azaspiro[4.4]nonane-1,6-dione (PubChem CID 171779142) has the molecular formula C13H12ClNO3 and a molecular weight of 265.70 g/mol. Its IUPAC name is 7-(4-chlorophenyl)-2-oxa-7-azaspiro[4.4]nonane-1,6-dione.
| Compound Name | 7-(4-chlorophenyl)-2-oxa-7-azaspiro[4.4]nonane-1,6-dione |
|---|---|
| PubChem CID | 171779142 |
| Molecular Formula | C13H12ClNO3 |
| Molecular Weight | 265.70 g/mol |
| Exact Mass | 265.05 |
| IUPAC Name | 7-(4-chlorophenyl)-2-oxa-7-azaspiro[4.4]nonane-1,6-dione |
| SMILES | O=C1OCCC12CCN(c1ccc(Cl)cc1)C2=O |
| InChI | InChI=1S/C13H12ClNO3/c14-9-1-3-10(4-2-9)15-7-5-13(11(15)16)6-8-18-12(13)17/h1-4H,5-8H2 |
| InChIKey | IFWWAPASXFPLRA-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.70 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|