C26H41N5O2 — CID 74555837
N-[[1-[(2-methylphenyl)methyl]piperidin-4-yl]methyl]-N-(oxolan-2-ylmethyl)-2,3,3a,4,5,6,7,7a-octahydro-1H-benzotriazole-5-carboxamide (PubChem CID 74555837) has the molecular formula C26H41N5O2 and a molecular weight of 455.65 g/mol. Its IUPAC name is N-[[1-[(2-methylphenyl)methyl]piperidin-4-yl]methyl]-N-(oxolan-2-ylmethyl)-2,3,3a,4,5,6,7,7a-octahydro-1H-benzotriazole-5-carboxamide.
| Compound Name | N-[[1-[(2-methylphenyl)methyl]piperidin-4-yl]methyl]-N-(oxolan-2-ylmethyl)-2,3,3a,4,5,6,7,7a-octahydro-1H-benzotriazole-5-carboxamide |
|---|---|
| PubChem CID | 74555837 |
| Molecular Formula | C26H41N5O2 |
| Molecular Weight | 455.65 g/mol |
| Exact Mass | 455.33 |
| IUPAC Name | N-[[1-[(2-methylphenyl)methyl]piperidin-4-yl]methyl]-N-(oxolan-2-ylmethyl)-2,3,3a,4,5,6,7,7a-octahydro-1H-benzotriazole-5-carboxamide |
| SMILES | Cc1ccccc1CN1CCC(CN(CC2CCCO2)C(=O)C2CCC3NNNC3C2)CC1 |
| InChI | InChI=1S/C26H41N5O2/c1-19-5-2-3-6-22(19)17-30-12-10-20(11-13-30)16-31(18-23-7-4-14-33-23)26(32)21-8-9-24-25(15-21)28-29-27-24/h2-3,5-6,20-21,23-25,27-29H,4,7-18H2,1H3 |
| InChIKey | IXOPSAKVSCPMBW-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.65 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |