C22H28ClN3O — CID 74570100
2-chloro-4-[[3-[4-(3-methylphenyl)pyrazolidin-3-yl]piperidin-1-yl]methyl]phenol (PubChem CID 74570100) has the molecular formula C22H28ClN3O and a molecular weight of 385.94 g/mol. Its IUPAC name is 2-chloro-4-[[3-[4-(3-methylphenyl)pyrazolidin-3-yl]piperidin-1-yl]methyl]phenol.
| Compound Name | 2-chloro-4-[[3-[4-(3-methylphenyl)pyrazolidin-3-yl]piperidin-1-yl]methyl]phenol |
|---|---|
| PubChem CID | 74570100 |
| Molecular Formula | C22H28ClN3O |
| Molecular Weight | 385.94 g/mol |
| Exact Mass | 385.19 |
| IUPAC Name | 2-chloro-4-[[3-[4-(3-methylphenyl)pyrazolidin-3-yl]piperidin-1-yl]methyl]phenol |
| SMILES | Cc1cccc(C2CNNC2C2CCCN(Cc3ccc(O)c(Cl)c3)C2)c1 |
| InChI | InChI=1S/C22H28ClN3O/c1-15-4-2-5-17(10-15)19-12-24-25-22(19)18-6-3-9-26(14-18)13-16-7-8-21(27)20(23)11-16/h2,4-5,7-8,10-11,18-19,22,24-25,27H,3,6,9,12-14H2,1H3 |
| InChIKey | QGDIPKMRJXHADD-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 47.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.94 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |