C14H21BrN3O3S+ — CID 7457052
N-(4-bromophenyl)-N-[2-(4-methylpiperazin-4-ium-1-yl)-2-oxoethyl]methanesulfonamide (PubChem CID 7457052) has the molecular formula C14H21BrN3O3S+ and a molecular weight of 391.31 g/mol. Its IUPAC name is N-(4-bromophenyl)-N-[2-(4-methylpiperazin-4-ium-1-yl)-2-oxoethyl]methanesulfonamide.
| Compound Name | N-(4-bromophenyl)-N-[2-(4-methylpiperazin-4-ium-1-yl)-2-oxoethyl]methanesulfonamide |
|---|---|
| PubChem CID | 7457052 |
| Molecular Formula | C14H21BrN3O3S+ |
| Molecular Weight | 391.31 g/mol |
| Exact Mass | 390.05 |
| IUPAC Name | N-(4-bromophenyl)-N-[2-(4-methylpiperazin-4-ium-1-yl)-2-oxoethyl]methanesulfonamide |
| SMILES | C[NH+]1CCN(C(=O)CN(c2ccc(Br)cc2)S(C)(=O)=O)CC1 |
| InChI | InChI=1S/C14H20BrN3O3S/c1-16-7-9-17(10-8-16)14(19)11-18(22(2,20)21)13-5-3-12(15)4-6-13/h3-6H,7-11H2,1-2H3/p+1 |
| InChIKey | MJTVMRMABCOTHJ-UHFFFAOYSA-O |
| XLogP | -0.43 |
| TPSA | 62.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.31 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |