C17H28N3O3S+ — CID 6964825
N-[2-(4-methylpiperazin-4-ium-1-yl)-2-oxoethyl]-N-(4-propan-2-ylphenyl)methanesulfonamide (PubChem CID 6964825) has the molecular formula C17H28N3O3S+ and a molecular weight of 354.50 g/mol. Its IUPAC name is N-[2-(4-methylpiperazin-4-ium-1-yl)-2-oxoethyl]-N-(4-propan-2-ylphenyl)methanesulfonamide.
| Compound Name | N-[2-(4-methylpiperazin-4-ium-1-yl)-2-oxoethyl]-N-(4-propan-2-ylphenyl)methanesulfonamide |
|---|---|
| PubChem CID | 6964825 |
| Molecular Formula | C17H28N3O3S+ |
| Molecular Weight | 354.50 g/mol |
| Exact Mass | 354.18 |
| IUPAC Name | N-[2-(4-methylpiperazin-4-ium-1-yl)-2-oxoethyl]-N-(4-propan-2-ylphenyl)methanesulfonamide |
| SMILES | CC(C)c1ccc(N(CC(=O)N2CC[NH+](C)CC2)S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C17H27N3O3S/c1-14(2)15-5-7-16(8-6-15)20(24(4,22)23)13-17(21)19-11-9-18(3)10-12-19/h5-8,14H,9-13H2,1-4H3/p+1 |
| InChIKey | KXYRYPMMWFNILO-UHFFFAOYSA-O |
| XLogP | -0.07 |
| TPSA | 62.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.50 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |