C29H44N2O4 — CID 74578539
N-[8-hydroxy-1,4a-dimethyl-7-[1-(4-methylpiperidin-1-yl)-1-oxopropan-2-yl]-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-2-yl]-4-methoxybenzamide (PubChem CID 74578539) has the molecular formula C29H44N2O4 and a molecular weight of 484.68 g/mol. Its IUPAC name is N-[8-hydroxy-1,4a-dimethyl-7-[1-(4-methylpiperidin-1-yl)-1-oxopropan-2-yl]-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-2-yl]-4-methoxybenzamide.
| Compound Name | N-[8-hydroxy-1,4a-dimethyl-7-[1-(4-methylpiperidin-1-yl)-1-oxopropan-2-yl]-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-2-yl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 74578539 |
| Molecular Formula | C29H44N2O4 |
| Molecular Weight | 484.68 g/mol |
| Exact Mass | 484.33 |
| IUPAC Name | N-[8-hydroxy-1,4a-dimethyl-7-[1-(4-methylpiperidin-1-yl)-1-oxopropan-2-yl]-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-2-yl]-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)NC2CCC3(C)CCC(C(C)C(=O)N4CCC(C)CC4)C(O)C3C2C)cc1 |
| InChI | InChI=1S/C29H44N2O4/c1-18-12-16-31(17-13-18)28(34)19(2)23-10-14-29(4)15-11-24(20(3)25(29)26(23)32)30-27(33)21-6-8-22(35-5)9-7-21/h6-9,18-20,23-26,32H,10-17H2,1-5H3,(H,30,33) |
| InChIKey | KBMOCQZCBIHWQM-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.68 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |