C28H42N2O4 — CID 74578541
N-[8-hydroxy-1,4a-dimethyl-7-(1-oxo-1-piperidin-1-ylpropan-2-yl)-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-2-yl]-4-methoxybenzamide (PubChem CID 74578541) has the molecular formula C28H42N2O4 and a molecular weight of 470.65 g/mol. Its IUPAC name is N-[8-hydroxy-1,4a-dimethyl-7-(1-oxo-1-piperidin-1-ylpropan-2-yl)-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-2-yl]-4-methoxybenzamide.
| Compound Name | N-[8-hydroxy-1,4a-dimethyl-7-(1-oxo-1-piperidin-1-ylpropan-2-yl)-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-2-yl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 74578541 |
| Molecular Formula | C28H42N2O4 |
| Molecular Weight | 470.65 g/mol |
| Exact Mass | 470.31 |
| IUPAC Name | N-[8-hydroxy-1,4a-dimethyl-7-(1-oxo-1-piperidin-1-ylpropan-2-yl)-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-2-yl]-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)NC2CCC3(C)CCC(C(C)C(=O)N4CCCCC4)C(O)C3C2C)cc1 |
| InChI | InChI=1S/C28H42N2O4/c1-18(27(33)30-16-6-5-7-17-30)22-12-14-28(3)15-13-23(19(2)24(28)25(22)31)29-26(32)20-8-10-21(34-4)11-9-20/h8-11,18-19,22-25,31H,5-7,12-17H2,1-4H3,(H,29,32) |
| InChIKey | GUGPRZVEWMEZDK-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.65 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |