C26H37FN2O3 — CID 28962823
N-[(1S,2S,4aS,7R,8S,8aS)-8-hydroxy-1,4a-dimethyl-7-[(2S)-1-oxo-1-pyrrolidin-1-ylpropan-2-yl]-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-2-yl]-3-fluorobenzamide (PubChem CID 28962823) has the molecular formula C26H37FN2O3 and a molecular weight of 444.59 g/mol. Its IUPAC name is N-[(1S,2S,4aS,7R,8S,8aS)-8-hydroxy-1,4a-dimethyl-7-[(2S)-1-oxo-1-pyrrolidin-1-ylpropan-2-yl]-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-2-yl]-3-fluorobenzamide.
| Compound Name | N-[(1S,2S,4aS,7R,8S,8aS)-8-hydroxy-1,4a-dimethyl-7-[(2S)-1-oxo-1-pyrrolidin-1-ylpropan-2-yl]-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-2-yl]-3-fluorobenzamide |
|---|---|
| PubChem CID | 28962823 |
| Molecular Formula | C26H37FN2O3 |
| Molecular Weight | 444.59 g/mol |
| Exact Mass | 444.28 |
| IUPAC Name | N-[(1S,2S,4aS,7R,8S,8aS)-8-hydroxy-1,4a-dimethyl-7-[(2S)-1-oxo-1-pyrrolidin-1-ylpropan-2-yl]-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-2-yl]-3-fluorobenzamide |
| SMILES | C[C@H]1[C@@H]2[C@@H](O)[C@@H]([C@H](C)C(=O)N3CCCC3)CC[C@@]2(C)CC[C@@H]1NC(=O)c1cccc(F)c1 |
| InChI | InChI=1S/C26H37FN2O3/c1-16(25(32)29-13-4-5-14-29)20-9-11-26(3)12-10-21(17(2)22(26)23(20)30)28-24(31)18-7-6-8-19(27)15-18/h6-8,15-17,20-23,30H,4-5,9-14H2,1-3H3,(H,28,31)/t16-,17+,20+,21-,22+,23-,26-/m0/s1 |
| InChIKey | BJTTWKROHZIMGX-NFIYDPBHSA-N |
| XLogP | 4.01 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.59 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |