C26H38FN3O4 — CID 163152536
1-[(1R,2S,4aR,7S,8S,8aS)-8-hydroxy-1,4a-dimethyl-7-[(2S)-1-morpholin-4-yl-1-oxopropan-2-yl]-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-2-yl]-3-(3-fluorophenyl)urea (PubChem CID 163152536) has the molecular formula C26H38FN3O4 and a molecular weight of 475.61 g/mol. Its IUPAC name is 1-[(1R,2S,4aR,7S,8S,8aS)-8-hydroxy-1,4a-dimethyl-7-[(2S)-1-morpholin-4-yl-1-oxopropan-2-yl]-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-2-yl]-3-(3-fluorophenyl)urea.
| Compound Name | 1-[(1R,2S,4aR,7S,8S,8aS)-8-hydroxy-1,4a-dimethyl-7-[(2S)-1-morpholin-4-yl-1-oxopropan-2-yl]-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-2-yl]-3-(3-fluorophenyl)urea |
|---|---|
| PubChem CID | 163152536 |
| Molecular Formula | C26H38FN3O4 |
| Molecular Weight | 475.61 g/mol |
| Exact Mass | 475.28 |
| IUPAC Name | 1-[(1R,2S,4aR,7S,8S,8aS)-8-hydroxy-1,4a-dimethyl-7-[(2S)-1-morpholin-4-yl-1-oxopropan-2-yl]-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-2-yl]-3-(3-fluorophenyl)urea |
| SMILES | C[C@@H]1[C@@H]2[C@@H](O)[C@H]([C@H](C)C(=O)N3CCOCC3)CC[C@]2(C)CC[C@@H]1NC(=O)Nc1cccc(F)c1 |
| InChI | InChI=1S/C26H38FN3O4/c1-16(24(32)30-11-13-34-14-12-30)20-7-9-26(3)10-8-21(17(2)22(26)23(20)31)29-25(33)28-19-6-4-5-18(27)15-19/h4-6,15-17,20-23,31H,7-14H2,1-3H3,(H2,28,29,33)/t16-,17-,20-,21-,22+,23-,26+/m0/s1 |
| InChIKey | NWMIKVUFUCIPPD-WZAQAUHGSA-N |
| XLogP | 3.63 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.61 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |