C27H36FN3O4 — CID 45361661
(2S)-2-[(1S,4aS,7S,8S,8aS)-7-[(3-fluorophenyl)carbamoylamino]-1-hydroxy-4a,8-dimethyl-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-2-yl]-N-(furan-2-ylmethyl)propanamide (PubChem CID 45361661) has the molecular formula C27H36FN3O4 and a molecular weight of 485.60 g/mol. Its IUPAC name is (2S)-2-[(1S,4aS,7S,8S,8aS)-7-[(3-fluorophenyl)carbamoylamino]-1-hydroxy-4a,8-dimethyl-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-2-yl]-N-(furan-2-ylmethyl)propanamide.
| Compound Name | (2S)-2-[(1S,4aS,7S,8S,8aS)-7-[(3-fluorophenyl)carbamoylamino]-1-hydroxy-4a,8-dimethyl-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-2-yl]-N-(furan-2-ylmethyl)propanamide |
|---|---|
| PubChem CID | 45361661 |
| Molecular Formula | C27H36FN3O4 |
| Molecular Weight | 485.60 g/mol |
| Exact Mass | 485.27 |
| IUPAC Name | (2S)-2-[(1S,4aS,7S,8S,8aS)-7-[(3-fluorophenyl)carbamoylamino]-1-hydroxy-4a,8-dimethyl-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-2-yl]-N-(furan-2-ylmethyl)propanamide |
| SMILES | C[C@H]1[C@@H]2[C@@H](O)C([C@H](C)C(=O)NCc3ccco3)CC[C@@]2(C)CC[C@@H]1NC(=O)Nc1cccc(F)c1 |
| InChI | InChI=1S/C27H36FN3O4/c1-16(25(33)29-15-20-8-5-13-35-20)21-9-11-27(3)12-10-22(17(2)23(27)24(21)32)31-26(34)30-19-7-4-6-18(28)14-19/h4-8,13-14,16-17,21-24,32H,9-12,15H2,1-3H3,(H,29,33)(H2,30,31,34)/t16-,17+,21?,22-,23+,24-,27-/m0/s1 |
| InChIKey | ICZMWROTBALGCY-GQEAFVQQSA-N |
| XLogP | 4.68 |
| TPSA | 103.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.60 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |