C22H35N3O4S — CID 74578802
2-[1-hydroxy-7-(methanesulfonamido)-4a,8-dimethyl-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-2-yl]-N-(pyridin-2-ylmethyl)propanamide (PubChem CID 74578802) has the molecular formula C22H35N3O4S and a molecular weight of 437.61 g/mol. Its IUPAC name is 2-[1-hydroxy-7-(methanesulfonamido)-4a,8-dimethyl-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-2-yl]-N-(pyridin-2-ylmethyl)propanamide.
| Compound Name | 2-[1-hydroxy-7-(methanesulfonamido)-4a,8-dimethyl-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-2-yl]-N-(pyridin-2-ylmethyl)propanamide |
|---|---|
| PubChem CID | 74578802 |
| Molecular Formula | C22H35N3O4S |
| Molecular Weight | 437.61 g/mol |
| Exact Mass | 437.23 |
| IUPAC Name | 2-[1-hydroxy-7-(methanesulfonamido)-4a,8-dimethyl-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-2-yl]-N-(pyridin-2-ylmethyl)propanamide |
| SMILES | CC(C(=O)NCc1ccccn1)C1CCC2(C)CCC(NS(C)(=O)=O)C(C)C2C1O |
| InChI | InChI=1S/C22H35N3O4S/c1-14(21(27)24-13-16-7-5-6-12-23-16)17-8-10-22(3)11-9-18(25-30(4,28)29)15(2)19(22)20(17)26/h5-7,12,14-15,17-20,25-26H,8-11,13H2,1-4H3,(H,24,27) |
| InChIKey | UCBAQLIELUYKDX-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 108.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.61 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |