C24H38N4O3 — CID 45361656
(2S)-2-[(1S,4aS,7S,8S,8aS)-7-(ethylcarbamoylamino)-1-hydroxy-4a,8-dimethyl-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-2-yl]-N-(pyridin-2-ylmethyl)propanamide (PubChem CID 45361656) has the molecular formula C24H38N4O3 and a molecular weight of 430.59 g/mol. Its IUPAC name is (2S)-2-[(1S,4aS,7S,8S,8aS)-7-(ethylcarbamoylamino)-1-hydroxy-4a,8-dimethyl-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-2-yl]-N-(pyridin-2-ylmethyl)propanamide.
| Compound Name | (2S)-2-[(1S,4aS,7S,8S,8aS)-7-(ethylcarbamoylamino)-1-hydroxy-4a,8-dimethyl-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-2-yl]-N-(pyridin-2-ylmethyl)propanamide |
|---|---|
| PubChem CID | 45361656 |
| Molecular Formula | C24H38N4O3 |
| Molecular Weight | 430.59 g/mol |
| Exact Mass | 430.29 |
| IUPAC Name | (2S)-2-[(1S,4aS,7S,8S,8aS)-7-(ethylcarbamoylamino)-1-hydroxy-4a,8-dimethyl-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-2-yl]-N-(pyridin-2-ylmethyl)propanamide |
| SMILES | CCNC(=O)N[C@H]1CC[C@]2(C)CCC([C@H](C)C(=O)NCc3ccccn3)[C@H](O)[C@H]2[C@@H]1C |
| InChI | InChI=1S/C24H38N4O3/c1-5-25-23(31)28-19-10-12-24(4)11-9-18(21(29)20(24)16(19)3)15(2)22(30)27-14-17-8-6-7-13-26-17/h6-8,13,15-16,18-21,29H,5,9-12,14H2,1-4H3,(H,27,30)(H2,25,28,31)/t15-,16+,18?,19-,20+,21-,24-/m0/s1 |
| InChIKey | CZXIJGOTENLNMC-BJZUZIJGSA-N |
| XLogP | 2.84 |
| TPSA | 103.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.59 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |