C29H36N4O3 — CID 95222773
N-[(1S,2S,4aS,7S,8S,8aS)-8-hydroxy-1,4a-dimethyl-7-[(2S)-1-oxo-1-(pyridin-2-ylmethylamino)propan-2-yl]-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-2-yl]-4-cyanobenzamide (PubChem CID 95222773) has the molecular formula C29H36N4O3 and a molecular weight of 488.63 g/mol. Its IUPAC name is N-[(1S,2S,4aS,7S,8S,8aS)-8-hydroxy-1,4a-dimethyl-7-[(2S)-1-oxo-1-(pyridin-2-ylmethylamino)propan-2-yl]-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-2-yl]-4-cyanobenzamide.
| Compound Name | N-[(1S,2S,4aS,7S,8S,8aS)-8-hydroxy-1,4a-dimethyl-7-[(2S)-1-oxo-1-(pyridin-2-ylmethylamino)propan-2-yl]-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-2-yl]-4-cyanobenzamide |
|---|---|
| PubChem CID | 95222773 |
| Molecular Formula | C29H36N4O3 |
| Molecular Weight | 488.63 g/mol |
| Exact Mass | 488.28 |
| IUPAC Name | N-[(1S,2S,4aS,7S,8S,8aS)-8-hydroxy-1,4a-dimethyl-7-[(2S)-1-oxo-1-(pyridin-2-ylmethylamino)propan-2-yl]-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-2-yl]-4-cyanobenzamide |
| SMILES | C[C@H]1[C@@H]2[C@@H](O)[C@H]([C@H](C)C(=O)NCc3ccccn3)CC[C@@]2(C)CC[C@@H]1NC(=O)c1ccc(C#N)cc1 |
| InChI | InChI=1S/C29H36N4O3/c1-18(27(35)32-17-22-6-4-5-15-31-22)23-11-13-29(3)14-12-24(19(2)25(29)26(23)34)33-28(36)21-9-7-20(16-30)8-10-21/h4-10,15,18-19,23-26,34H,11-14,17H2,1-3H3,(H,32,35)(H,33,36)/t18-,19+,23-,24-,25+,26-,29-/m0/s1 |
| InChIKey | PWOSYVJDYHFUOB-NGJRIMDPSA-N |
| XLogP | 3.83 |
| TPSA | 115.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.63 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |