C21H38N2O4S — CID 74578804
N-[8-hydroxy-1,4a-dimethyl-7-(1-oxo-1-piperidin-1-ylpropan-2-yl)-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-2-yl]methanesulfonamide (PubChem CID 74578804) has the molecular formula C21H38N2O4S and a molecular weight of 414.61 g/mol. Its IUPAC name is N-[8-hydroxy-1,4a-dimethyl-7-(1-oxo-1-piperidin-1-ylpropan-2-yl)-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-2-yl]methanesulfonamide.
| Compound Name | N-[8-hydroxy-1,4a-dimethyl-7-(1-oxo-1-piperidin-1-ylpropan-2-yl)-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-2-yl]methanesulfonamide |
|---|---|
| PubChem CID | 74578804 |
| Molecular Formula | C21H38N2O4S |
| Molecular Weight | 414.61 g/mol |
| Exact Mass | 414.26 |
| IUPAC Name | N-[8-hydroxy-1,4a-dimethyl-7-(1-oxo-1-piperidin-1-ylpropan-2-yl)-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-2-yl]methanesulfonamide |
| SMILES | CC(C(=O)N1CCCCC1)C1CCC2(C)CCC(NS(C)(=O)=O)C(C)C2C1O |
| InChI | InChI=1S/C21H38N2O4S/c1-14(20(25)23-12-6-5-7-13-23)16-8-10-21(3)11-9-17(22-28(4,26)27)15(2)18(21)19(16)24/h14-19,22,24H,5-13H2,1-4H3 |
| InChIKey | FOIFARVSUNWJFP-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.61 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |