C21H38N2O4S — CID 45361670
(2S)-2-[(1S,4aS,7S,8S,8aS)-1-hydroxy-7-(methanesulfonamido)-4a,8-dimethyl-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-2-yl]-N-cyclopentylpropanamide (PubChem CID 45361670) has the molecular formula C21H38N2O4S and a molecular weight of 414.61 g/mol. Its IUPAC name is (2S)-2-[(1S,4aS,7S,8S,8aS)-1-hydroxy-7-(methanesulfonamido)-4a,8-dimethyl-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-2-yl]-N-cyclopentylpropanamide.
| Compound Name | (2S)-2-[(1S,4aS,7S,8S,8aS)-1-hydroxy-7-(methanesulfonamido)-4a,8-dimethyl-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-2-yl]-N-cyclopentylpropanamide |
|---|---|
| PubChem CID | 45361670 |
| Molecular Formula | C21H38N2O4S |
| Molecular Weight | 414.61 g/mol |
| Exact Mass | 414.26 |
| IUPAC Name | (2S)-2-[(1S,4aS,7S,8S,8aS)-1-hydroxy-7-(methanesulfonamido)-4a,8-dimethyl-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-2-yl]-N-cyclopentylpropanamide |
| SMILES | C[C@H]1[C@@H]2[C@@H](O)C([C@H](C)C(=O)NC3CCCC3)CC[C@@]2(C)CC[C@@H]1NS(C)(=O)=O |
| InChI | InChI=1S/C21H38N2O4S/c1-13(20(25)22-15-7-5-6-8-15)16-9-11-21(3)12-10-17(23-28(4,26)27)14(2)18(21)19(16)24/h13-19,23-24H,5-12H2,1-4H3,(H,22,25)/t13-,14+,16?,17-,18+,19-,21-/m0/s1 |
| InChIKey | UYABGBLEKDBAOL-HJPJDBPWSA-N |
| XLogP | 2.42 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.61 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |