C24H42N2O4 — CID 74578712
N-cyclopentyl-2-[1-hydroxy-7-(3-methoxypropanoylamino)-4a,8-dimethyl-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-2-yl]propanamide (PubChem CID 74578712) has the molecular formula C24H42N2O4 and a molecular weight of 422.61 g/mol. Its IUPAC name is N-cyclopentyl-2-[1-hydroxy-7-(3-methoxypropanoylamino)-4a,8-dimethyl-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-2-yl]propanamide.
| Compound Name | N-cyclopentyl-2-[1-hydroxy-7-(3-methoxypropanoylamino)-4a,8-dimethyl-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-2-yl]propanamide |
|---|---|
| PubChem CID | 74578712 |
| Molecular Formula | C24H42N2O4 |
| Molecular Weight | 422.61 g/mol |
| Exact Mass | 422.31 |
| IUPAC Name | N-cyclopentyl-2-[1-hydroxy-7-(3-methoxypropanoylamino)-4a,8-dimethyl-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-2-yl]propanamide |
| SMILES | COCCC(=O)NC1CCC2(C)CCC(C(C)C(=O)NC3CCCC3)C(O)C2C1C |
| InChI | InChI=1S/C24H42N2O4/c1-15(23(29)25-17-7-5-6-8-17)18-9-12-24(3)13-10-19(16(2)21(24)22(18)28)26-20(27)11-14-30-4/h15-19,21-22,28H,5-14H2,1-4H3,(H,25,29)(H,26,27) |
| InChIKey | GEQWUBLKSRVCLJ-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.61 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |