C29H44N2O3 — CID 28962880
(2S)-2-[(1S,2R,4aS,7S,8S,8aS)-1-hydroxy-4a,8-dimethyl-7-[(2-phenylacetyl)amino]-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-2-yl]-N-cyclohexylpropanamide (PubChem CID 28962880) has the molecular formula C29H44N2O3 and a molecular weight of 468.68 g/mol. Its IUPAC name is (2S)-2-[(1S,2R,4aS,7S,8S,8aS)-1-hydroxy-4a,8-dimethyl-7-[(2-phenylacetyl)amino]-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-2-yl]-N-cyclohexylpropanamide.
| Compound Name | (2S)-2-[(1S,2R,4aS,7S,8S,8aS)-1-hydroxy-4a,8-dimethyl-7-[(2-phenylacetyl)amino]-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-2-yl]-N-cyclohexylpropanamide |
|---|---|
| PubChem CID | 28962880 |
| Molecular Formula | C29H44N2O3 |
| Molecular Weight | 468.68 g/mol |
| Exact Mass | 468.34 |
| IUPAC Name | (2S)-2-[(1S,2R,4aS,7S,8S,8aS)-1-hydroxy-4a,8-dimethyl-7-[(2-phenylacetyl)amino]-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-2-yl]-N-cyclohexylpropanamide |
| SMILES | C[C@H]1[C@@H]2[C@@H](O)[C@@H]([C@H](C)C(=O)NC3CCCCC3)CC[C@@]2(C)CC[C@@H]1NC(=O)Cc1ccccc1 |
| InChI | InChI=1S/C29H44N2O3/c1-19(28(34)30-22-12-8-5-9-13-22)23-14-16-29(3)17-15-24(20(2)26(29)27(23)33)31-25(32)18-21-10-6-4-7-11-21/h4,6-7,10-11,19-20,22-24,26-27,33H,5,8-9,12-18H2,1-3H3,(H,30,34)(H,31,32)/t19-,20+,23+,24-,26+,27-,29-/m0/s1 |
| InChIKey | UTDLFLXAYSODMF-YXQGMHLXSA-N |
| XLogP | 4.62 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.68 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |