C23H40N2O3 — CID 74578511
2-(7-acetamido-1-hydroxy-4a,8-dimethyl-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-2-yl)-N-cyclohexylpropanamide (PubChem CID 74578511) has the molecular formula C23H40N2O3 and a molecular weight of 392.58 g/mol. Its IUPAC name is 2-(7-acetamido-1-hydroxy-4a,8-dimethyl-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-2-yl)-N-cyclohexylpropanamide.
| Compound Name | 2-(7-acetamido-1-hydroxy-4a,8-dimethyl-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-2-yl)-N-cyclohexylpropanamide |
|---|---|
| PubChem CID | 74578511 |
| Molecular Formula | C23H40N2O3 |
| Molecular Weight | 392.58 g/mol |
| Exact Mass | 392.30 |
| IUPAC Name | 2-(7-acetamido-1-hydroxy-4a,8-dimethyl-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-2-yl)-N-cyclohexylpropanamide |
| SMILES | CC(=O)NC1CCC2(C)CCC(C(C)C(=O)NC3CCCCC3)C(O)C2C1C |
| InChI | InChI=1S/C23H40N2O3/c1-14(22(28)25-17-8-6-5-7-9-17)18-10-12-23(4)13-11-19(24-16(3)26)15(2)20(23)21(18)27/h14-15,17-21,27H,5-13H2,1-4H3,(H,24,26)(H,25,28) |
| InChIKey | MAYBNQJIYGYBCP-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.58 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |