C27H41N3O3 — CID 162802365
N-[(1R,2S,4aR,7S,8S,8aS)-7-[(2S)-1-(cyclohexylamino)-1-oxopropan-2-yl]-8-hydroxy-1,4a-dimethyl-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-2-yl]pyridine-4-carboxamide (PubChem CID 162802365) has the molecular formula C27H41N3O3 and a molecular weight of 455.64 g/mol. Its IUPAC name is N-[(1R,2S,4aR,7S,8S,8aS)-7-[(2S)-1-(cyclohexylamino)-1-oxopropan-2-yl]-8-hydroxy-1,4a-dimethyl-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-2-yl]pyridine-4-carboxamide.
| Compound Name | N-[(1R,2S,4aR,7S,8S,8aS)-7-[(2S)-1-(cyclohexylamino)-1-oxopropan-2-yl]-8-hydroxy-1,4a-dimethyl-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-2-yl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 162802365 |
| Molecular Formula | C27H41N3O3 |
| Molecular Weight | 455.64 g/mol |
| Exact Mass | 455.31 |
| IUPAC Name | N-[(1R,2S,4aR,7S,8S,8aS)-7-[(2S)-1-(cyclohexylamino)-1-oxopropan-2-yl]-8-hydroxy-1,4a-dimethyl-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-2-yl]pyridine-4-carboxamide |
| SMILES | C[C@@H]1[C@@H]2[C@@H](O)[C@H]([C@H](C)C(=O)NC3CCCCC3)CC[C@]2(C)CC[C@@H]1NC(=O)c1ccncc1 |
| InChI | InChI=1S/C27H41N3O3/c1-17(25(32)29-20-7-5-4-6-8-20)21-9-13-27(3)14-10-22(18(2)23(27)24(21)31)30-26(33)19-11-15-28-16-12-19/h11-12,15-18,20-24,31H,4-10,13-14H2,1-3H3,(H,29,32)(H,30,33)/t17-,18-,21-,22-,23+,24-,27+/m0/s1 |
| InChIKey | NKDAPVLWVMXFGL-IEOIVZQCSA-N |
| XLogP | 4.09 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.64 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |