C28H38N2O3S — CID 28962905
(2S)-2-[(1S,2R,4aS,7S,8S,8aS)-1-hydroxy-4a,8-dimethyl-7-[(2-phenylacetyl)amino]-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-2-yl]-N-(thiophen-2-ylmethyl)propanamide (PubChem CID 28962905) has the molecular formula C28H38N2O3S and a molecular weight of 482.69 g/mol. Its IUPAC name is (2S)-2-[(1S,2R,4aS,7S,8S,8aS)-1-hydroxy-4a,8-dimethyl-7-[(2-phenylacetyl)amino]-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-2-yl]-N-(thiophen-2-ylmethyl)propanamide.
| Compound Name | (2S)-2-[(1S,2R,4aS,7S,8S,8aS)-1-hydroxy-4a,8-dimethyl-7-[(2-phenylacetyl)amino]-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-2-yl]-N-(thiophen-2-ylmethyl)propanamide |
|---|---|
| PubChem CID | 28962905 |
| Molecular Formula | C28H38N2O3S |
| Molecular Weight | 482.69 g/mol |
| Exact Mass | 482.26 |
| IUPAC Name | (2S)-2-[(1S,2R,4aS,7S,8S,8aS)-1-hydroxy-4a,8-dimethyl-7-[(2-phenylacetyl)amino]-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-2-yl]-N-(thiophen-2-ylmethyl)propanamide |
| SMILES | C[C@H]1[C@@H]2[C@@H](O)[C@@H]([C@H](C)C(=O)NCc3cccs3)CC[C@@]2(C)CC[C@@H]1NC(=O)Cc1ccccc1 |
| InChI | InChI=1S/C28H38N2O3S/c1-18(27(33)29-17-21-10-7-15-34-21)22-11-13-28(3)14-12-23(19(2)25(28)26(22)32)30-24(31)16-20-8-5-4-6-9-20/h4-10,15,18-19,22-23,25-26,32H,11-14,16-17H2,1-3H3,(H,29,33)(H,30,31)/t18-,19+,22+,23-,25+,26-,28-/m0/s1 |
| InChIKey | WBFVEQDJXGHCAM-SDCRQWQISA-N |
| XLogP | 4.55 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.69 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |