C30H46N2O4 — CID 75112078
N-[8-hydroxy-7-[1-[(2-methoxyphenyl)methylamino]-1-oxopropan-2-yl]-1,4a-dimethyl-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-2-yl]cyclohexanecarboxamide (PubChem CID 75112078) has the molecular formula C30H46N2O4 and a molecular weight of 498.71 g/mol. Its IUPAC name is N-[8-hydroxy-7-[1-[(2-methoxyphenyl)methylamino]-1-oxopropan-2-yl]-1,4a-dimethyl-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-2-yl]cyclohexanecarboxamide.
| Compound Name | N-[8-hydroxy-7-[1-[(2-methoxyphenyl)methylamino]-1-oxopropan-2-yl]-1,4a-dimethyl-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-2-yl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 75112078 |
| Molecular Formula | C30H46N2O4 |
| Molecular Weight | 498.71 g/mol |
| Exact Mass | 498.35 |
| IUPAC Name | N-[8-hydroxy-7-[1-[(2-methoxyphenyl)methylamino]-1-oxopropan-2-yl]-1,4a-dimethyl-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-2-yl]cyclohexanecarboxamide |
| SMILES | COc1ccccc1CNC(=O)C(C)C1CCC2(C)CCC(NC(=O)C3CCCCC3)C(C)C2C1O |
| InChI | InChI=1S/C30H46N2O4/c1-19(28(34)31-18-22-12-8-9-13-25(22)36-4)23-14-16-30(3)17-15-24(20(2)26(30)27(23)33)32-29(35)21-10-6-5-7-11-21/h8-9,12-13,19-21,23-24,26-27,33H,5-7,10-11,14-18H2,1-4H3,(H,31,34)(H,32,35) |
| InChIKey | XICZIOJXNYTWMM-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.71 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |