C25H38N2O4 — CID 74578549
N-[8-hydroxy-7-[1-(2-methoxyethylamino)-1-oxopropan-2-yl]-1,4a-dimethyl-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-2-yl]benzamide (PubChem CID 74578549) has the molecular formula C25H38N2O4 and a molecular weight of 430.59 g/mol. Its IUPAC name is N-[8-hydroxy-7-[1-(2-methoxyethylamino)-1-oxopropan-2-yl]-1,4a-dimethyl-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-2-yl]benzamide.
| Compound Name | N-[8-hydroxy-7-[1-(2-methoxyethylamino)-1-oxopropan-2-yl]-1,4a-dimethyl-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-2-yl]benzamide |
|---|---|
| PubChem CID | 74578549 |
| Molecular Formula | C25H38N2O4 |
| Molecular Weight | 430.59 g/mol |
| Exact Mass | 430.28 |
| IUPAC Name | N-[8-hydroxy-7-[1-(2-methoxyethylamino)-1-oxopropan-2-yl]-1,4a-dimethyl-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-2-yl]benzamide |
| SMILES | COCCNC(=O)C(C)C1CCC2(C)CCC(NC(=O)c3ccccc3)C(C)C2C1O |
| InChI | InChI=1S/C25H38N2O4/c1-16(23(29)26-14-15-31-4)19-10-12-25(3)13-11-20(17(2)21(25)22(19)28)27-24(30)18-8-6-5-7-9-18/h5-9,16-17,19-22,28H,10-15H2,1-4H3,(H,26,29)(H,27,30) |
| InChIKey | IMNSLXQBEVZIPN-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.59 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|