C22H40N2O5 — CID 74578718
2-[1-hydroxy-7-(3-methoxypropanoylamino)-4a,8-dimethyl-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-2-yl]-N-(2-methoxyethyl)propanamide (PubChem CID 74578718) has the molecular formula C22H40N2O5 and a molecular weight of 412.57 g/mol. Its IUPAC name is 2-[1-hydroxy-7-(3-methoxypropanoylamino)-4a,8-dimethyl-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-2-yl]-N-(2-methoxyethyl)propanamide.
| Compound Name | 2-[1-hydroxy-7-(3-methoxypropanoylamino)-4a,8-dimethyl-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-2-yl]-N-(2-methoxyethyl)propanamide |
|---|---|
| PubChem CID | 74578718 |
| Molecular Formula | C22H40N2O5 |
| Molecular Weight | 412.57 g/mol |
| Exact Mass | 412.29 |
| IUPAC Name | 2-[1-hydroxy-7-(3-methoxypropanoylamino)-4a,8-dimethyl-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-2-yl]-N-(2-methoxyethyl)propanamide |
| SMILES | COCCNC(=O)C(C)C1CCC2(C)CCC(NC(=O)CCOC)C(C)C2C1O |
| InChI | InChI=1S/C22H40N2O5/c1-14(21(27)23-11-13-29-5)16-6-9-22(3)10-7-17(15(2)19(22)20(16)26)24-18(25)8-12-28-4/h14-17,19-20,26H,6-13H2,1-5H3,(H,23,27)(H,24,25) |
| InChIKey | IGAJOQKPOZBNNQ-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.57 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|