C22H40N2O4 — CID 38031389
(2S)-2-[(1S,2R,4aS,7S,8S,8aS)-1-hydroxy-7-[(2-methoxyacetyl)amino]-4a,8-dimethyl-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-2-yl]-N,N-diethylpropanamide (PubChem CID 38031389) has the molecular formula C22H40N2O4 and a molecular weight of 396.57 g/mol. Its IUPAC name is (2S)-2-[(1S,2R,4aS,7S,8S,8aS)-1-hydroxy-7-[(2-methoxyacetyl)amino]-4a,8-dimethyl-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-2-yl]-N,N-diethylpropanamide.
| Compound Name | (2S)-2-[(1S,2R,4aS,7S,8S,8aS)-1-hydroxy-7-[(2-methoxyacetyl)amino]-4a,8-dimethyl-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-2-yl]-N,N-diethylpropanamide |
|---|---|
| PubChem CID | 38031389 |
| Molecular Formula | C22H40N2O4 |
| Molecular Weight | 396.57 g/mol |
| Exact Mass | 396.30 |
| IUPAC Name | (2S)-2-[(1S,2R,4aS,7S,8S,8aS)-1-hydroxy-7-[(2-methoxyacetyl)amino]-4a,8-dimethyl-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-2-yl]-N,N-diethylpropanamide |
| SMILES | CCN(CC)C(=O)[C@@H](C)[C@H]1CC[C@@]2(C)CC[C@H](NC(=O)COC)[C@@H](C)[C@@H]2[C@H]1O |
| InChI | InChI=1S/C22H40N2O4/c1-7-24(8-2)21(27)14(3)16-9-11-22(5)12-10-17(23-18(25)13-28-6)15(4)19(22)20(16)26/h14-17,19-20,26H,7-13H2,1-6H3,(H,23,25)/t14-,15+,16+,17-,19+,20-,22-/m0/s1 |
| InChIKey | LPSKKVXXWOGLFU-PZWMYEMXSA-N |
| XLogP | 2.45 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.57 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |