C19H36N2O5S — CID 75616181
2-[1-hydroxy-7-(methanesulfonamido)-4a,8-dimethyl-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-2-yl]-N-(2-methoxyethyl)propanamide (PubChem CID 75616181) has the molecular formula C19H36N2O5S and a molecular weight of 404.57 g/mol. Its IUPAC name is 2-[1-hydroxy-7-(methanesulfonamido)-4a,8-dimethyl-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-2-yl]-N-(2-methoxyethyl)propanamide.
| Compound Name | 2-[1-hydroxy-7-(methanesulfonamido)-4a,8-dimethyl-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-2-yl]-N-(2-methoxyethyl)propanamide |
|---|---|
| PubChem CID | 75616181 |
| Molecular Formula | C19H36N2O5S |
| Molecular Weight | 404.57 g/mol |
| Exact Mass | 404.23 |
| IUPAC Name | 2-[1-hydroxy-7-(methanesulfonamido)-4a,8-dimethyl-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-2-yl]-N-(2-methoxyethyl)propanamide |
| SMILES | COCCNC(=O)C(C)C1CCC2(C)CCC(NS(C)(=O)=O)C(C)C2C1O |
| InChI | InChI=1S/C19H36N2O5S/c1-12(18(23)20-10-11-26-4)14-6-8-19(3)9-7-15(21-27(5,24)25)13(2)16(19)17(14)22/h12-17,21-22H,6-11H2,1-5H3,(H,20,23) |
| InChIKey | BLVFVCGLVODBEM-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.57 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|