C22H34N2O3S — CID 28962510
(2S)-2-[(1S,2R,4aS,7S,8S,8aS)-7-acetamido-1-hydroxy-4a,8-dimethyl-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-2-yl]-N-(thiophen-2-ylmethyl)propanamide (PubChem CID 28962510) has the molecular formula C22H34N2O3S and a molecular weight of 406.59 g/mol. Its IUPAC name is (2S)-2-[(1S,2R,4aS,7S,8S,8aS)-7-acetamido-1-hydroxy-4a,8-dimethyl-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-2-yl]-N-(thiophen-2-ylmethyl)propanamide.
| Compound Name | (2S)-2-[(1S,2R,4aS,7S,8S,8aS)-7-acetamido-1-hydroxy-4a,8-dimethyl-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-2-yl]-N-(thiophen-2-ylmethyl)propanamide |
|---|---|
| PubChem CID | 28962510 |
| Molecular Formula | C22H34N2O3S |
| Molecular Weight | 406.59 g/mol |
| Exact Mass | 406.23 |
| IUPAC Name | (2S)-2-[(1S,2R,4aS,7S,8S,8aS)-7-acetamido-1-hydroxy-4a,8-dimethyl-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-2-yl]-N-(thiophen-2-ylmethyl)propanamide |
| SMILES | CC(=O)N[C@H]1CC[C@]2(C)CC[C@H]([C@H](C)C(=O)NCc3cccs3)[C@H](O)[C@H]2[C@@H]1C |
| InChI | InChI=1S/C22H34N2O3S/c1-13(21(27)23-12-16-6-5-11-28-16)17-7-9-22(4)10-8-18(24-15(3)25)14(2)19(22)20(17)26/h5-6,11,13-14,17-20,26H,7-10,12H2,1-4H3,(H,23,27)(H,24,25)/t13-,14+,17+,18-,19+,20-,22-/m0/s1 |
| InChIKey | AFEMXOUMFWXKAR-AHOWEJGSSA-N |
| XLogP | 3.33 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.59 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |