C23H41N3O3 — CID 38031829
1-[(1S,2S,4aS,7R,8S,8aS)-8-hydroxy-1,4a-dimethyl-7-[(2S)-1-oxo-1-piperidin-1-ylpropan-2-yl]-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-2-yl]-3-ethylurea (PubChem CID 38031829) has the molecular formula C23H41N3O3 and a molecular weight of 407.60 g/mol. Its IUPAC name is 1-[(1S,2S,4aS,7R,8S,8aS)-8-hydroxy-1,4a-dimethyl-7-[(2S)-1-oxo-1-piperidin-1-ylpropan-2-yl]-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-2-yl]-3-ethylurea.
| Compound Name | 1-[(1S,2S,4aS,7R,8S,8aS)-8-hydroxy-1,4a-dimethyl-7-[(2S)-1-oxo-1-piperidin-1-ylpropan-2-yl]-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-2-yl]-3-ethylurea |
|---|---|
| PubChem CID | 38031829 |
| Molecular Formula | C23H41N3O3 |
| Molecular Weight | 407.60 g/mol |
| Exact Mass | 407.31 |
| IUPAC Name | 1-[(1S,2S,4aS,7R,8S,8aS)-8-hydroxy-1,4a-dimethyl-7-[(2S)-1-oxo-1-piperidin-1-ylpropan-2-yl]-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-2-yl]-3-ethylurea |
| SMILES | CCNC(=O)N[C@H]1CC[C@]2(C)CC[C@H]([C@H](C)C(=O)N3CCCCC3)[C@H](O)[C@H]2[C@@H]1C |
| InChI | InChI=1S/C23H41N3O3/c1-5-24-22(29)25-18-10-12-23(4)11-9-17(20(27)19(23)16(18)3)15(2)21(28)26-13-7-6-8-14-26/h15-20,27H,5-14H2,1-4H3,(H2,24,25,29)/t15-,16+,17+,18-,19+,20-,23-/m0/s1 |
| InChIKey | ZDRQWPVQLGSNIQ-CZQCFGCQSA-N |
| XLogP | 3.15 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.60 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |