C22H38N4O3 — CID 74578780
N-(2-cyanoethyl)-2-[7-(ethylcarbamoylamino)-1-hydroxy-4a,8-dimethyl-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-2-yl]-N-methylpropanamide (PubChem CID 74578780) has the molecular formula C22H38N4O3 and a molecular weight of 406.57 g/mol. Its IUPAC name is N-(2-cyanoethyl)-2-[7-(ethylcarbamoylamino)-1-hydroxy-4a,8-dimethyl-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-2-yl]-N-methylpropanamide.
| Compound Name | N-(2-cyanoethyl)-2-[7-(ethylcarbamoylamino)-1-hydroxy-4a,8-dimethyl-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-2-yl]-N-methylpropanamide |
|---|---|
| PubChem CID | 74578780 |
| Molecular Formula | C22H38N4O3 |
| Molecular Weight | 406.57 g/mol |
| Exact Mass | 406.29 |
| IUPAC Name | N-(2-cyanoethyl)-2-[7-(ethylcarbamoylamino)-1-hydroxy-4a,8-dimethyl-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-2-yl]-N-methylpropanamide |
| SMILES | CCNC(=O)NC1CCC2(C)CCC(C(C)C(=O)N(C)CCC#N)C(O)C2C1C |
| InChI | InChI=1S/C22H38N4O3/c1-6-24-21(29)25-17-9-11-22(4)10-8-16(19(27)18(22)15(17)3)14(2)20(28)26(5)13-7-12-23/h14-19,27H,6-11,13H2,1-5H3,(H2,24,25,29) |
| InChIKey | JTGOFPKLZCALSU-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 105.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.57 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |