C17H16N4O4S — CID 7458714
2-[[(4R)-3-acetyl-5-cyano-2-methyl-4-(3-nitrophenyl)-3,4-dihydropyridin-6-yl]sulfanyl]acetamide (PubChem CID 7458714) has the molecular formula C17H16N4O4S and a molecular weight of 372.41 g/mol. Its IUPAC name is 2-[[(4R)-3-acetyl-5-cyano-2-methyl-4-(3-nitrophenyl)-3,4-dihydropyridin-6-yl]sulfanyl]acetamide.
| Compound Name | 2-[[(4R)-3-acetyl-5-cyano-2-methyl-4-(3-nitrophenyl)-3,4-dihydropyridin-6-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 7458714 |
| Molecular Formula | C17H16N4O4S |
| Molecular Weight | 372.41 g/mol |
| Exact Mass | 372.09 |
| IUPAC Name | 2-[[(4R)-3-acetyl-5-cyano-2-methyl-4-(3-nitrophenyl)-3,4-dihydropyridin-6-yl]sulfanyl]acetamide |
| SMILES | CC(=O)C1C(C)=NC(SCC(N)=O)=C(C#N)[C@H]1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H16N4O4S/c1-9-15(10(2)22)16(11-4-3-5-12(6-11)21(24)25)13(7-18)17(20-9)26-8-14(19)23/h3-6,15-16H,8H2,1-2H3,(H2,19,23)/t15?,16-/m1/s1 |
| InChIKey | MZNOHMJCGUIRSG-OEMAIJDKSA-N |
| XLogP | 2.31 |
| TPSA | 139.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.41 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|