C24H24N5O5S+ — CID 142081636
ethyl 2-[4-[6-(2-amino-2-oxoethyl)sulfanyl-5-cyano-2-methyl-4-(3-nitrophenyl)-1,4-dihydropyridin-3-yl]pyridin-1-ium-1-yl]acetate (PubChem CID 142081636) has the molecular formula C24H24N5O5S+ and a molecular weight of 494.55 g/mol. Its IUPAC name is ethyl 2-[4-[6-(2-amino-2-oxoethyl)sulfanyl-5-cyano-2-methyl-4-(3-nitrophenyl)-1,4-dihydropyridin-3-yl]pyridin-1-ium-1-yl]acetate.
| Compound Name | ethyl 2-[4-[6-(2-amino-2-oxoethyl)sulfanyl-5-cyano-2-methyl-4-(3-nitrophenyl)-1,4-dihydropyridin-3-yl]pyridin-1-ium-1-yl]acetate |
|---|---|
| PubChem CID | 142081636 |
| Molecular Formula | C24H24N5O5S+ |
| Molecular Weight | 494.55 g/mol |
| Exact Mass | 494.15 |
| IUPAC Name | ethyl 2-[4-[6-(2-amino-2-oxoethyl)sulfanyl-5-cyano-2-methyl-4-(3-nitrophenyl)-1,4-dihydropyridin-3-yl]pyridin-1-ium-1-yl]acetate |
| SMILES | CCOC(=O)C[n+]1ccc(C2=C(C)NC(SCC(N)=O)=C(C#N)C2c2cccc([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C24H23N5O5S/c1-3-34-21(31)13-28-9-7-16(8-10-28)22-15(2)27-24(35-14-20(26)30)19(12-25)23(22)17-5-4-6-18(11-17)29(32)33/h4-11,23H,3,13-14H2,1-2H3,(H2,26,30)/p+1 |
| InChIKey | KGIBIEBKEZSDKR-UHFFFAOYSA-O |
| XLogP | 2.52 |
| TPSA | 152.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.55 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|