C22H20ClN2O3+ — CID 7460539
(3aR,4S,8aS,8bS)-4-benzoyl-2-(4-chlorophenyl)-3a,4,5,6,7,8,8a,8b-octahydropyrrolo[3,4-a]pyrrolizin-5-ium-1,3-dione (PubChem CID 7460539) has the molecular formula C22H20ClN2O3+ and a molecular weight of 395.87 g/mol. Its IUPAC name is (3aR,4S,8aS,8bS)-4-benzoyl-2-(4-chlorophenyl)-3a,4,5,6,7,8,8a,8b-octahydropyrrolo[3,4-a]pyrrolizin-5-ium-1,3-dione.
| Compound Name | (3aR,4S,8aS,8bS)-4-benzoyl-2-(4-chlorophenyl)-3a,4,5,6,7,8,8a,8b-octahydropyrrolo[3,4-a]pyrrolizin-5-ium-1,3-dione |
|---|---|
| PubChem CID | 7460539 |
| Molecular Formula | C22H20ClN2O3+ |
| Molecular Weight | 395.87 g/mol |
| Exact Mass | 395.12 |
| IUPAC Name | (3aR,4S,8aS,8bS)-4-benzoyl-2-(4-chlorophenyl)-3a,4,5,6,7,8,8a,8b-octahydropyrrolo[3,4-a]pyrrolizin-5-ium-1,3-dione |
| SMILES | O=C(c1ccccc1)[C@@H]1[C@@H]2C(=O)N(c3ccc(Cl)cc3)C(=O)[C@@H]2[C@@H]2CCC[NH+]12 |
| InChI | InChI=1S/C22H19ClN2O3/c23-14-8-10-15(11-9-14)25-21(27)17-16-7-4-12-24(16)19(18(17)22(25)28)20(26)13-5-2-1-3-6-13/h1-3,5-6,8-11,16-19H,4,7,12H2/p+1/t16-,17+,18+,19-/m0/s1 |
| InChIKey | LNFNIZFZHGGWDR-MANSERQUSA-O |
| XLogP | 1.76 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.87 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|