C22H20FN2O3+ — CID 7494328
(3aR,4S,8aR,8bS)-4-benzoyl-2-(3-fluorophenyl)-3a,4,5,6,7,8,8a,8b-octahydropyrrolo[3,4-a]pyrrolizin-5-ium-1,3-dione (PubChem CID 7494328) has the molecular formula C22H20FN2O3+ and a molecular weight of 379.41 g/mol. Its IUPAC name is (3aR,4S,8aR,8bS)-4-benzoyl-2-(3-fluorophenyl)-3a,4,5,6,7,8,8a,8b-octahydropyrrolo[3,4-a]pyrrolizin-5-ium-1,3-dione.
| Compound Name | (3aR,4S,8aR,8bS)-4-benzoyl-2-(3-fluorophenyl)-3a,4,5,6,7,8,8a,8b-octahydropyrrolo[3,4-a]pyrrolizin-5-ium-1,3-dione |
|---|---|
| PubChem CID | 7494328 |
| Molecular Formula | C22H20FN2O3+ |
| Molecular Weight | 379.41 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | (3aR,4S,8aR,8bS)-4-benzoyl-2-(3-fluorophenyl)-3a,4,5,6,7,8,8a,8b-octahydropyrrolo[3,4-a]pyrrolizin-5-ium-1,3-dione |
| SMILES | O=C(c1ccccc1)[C@@H]1[C@@H]2C(=O)N(c3cccc(F)c3)C(=O)[C@@H]2[C@H]2CCC[NH+]21 |
| InChI | InChI=1S/C22H19FN2O3/c23-14-8-4-9-15(12-14)25-21(27)17-16-10-5-11-24(16)19(18(17)22(25)28)20(26)13-6-2-1-3-7-13/h1-4,6-9,12,16-19H,5,10-11H2/p+1/t16-,17-,18-,19+/m1/s1 |
| InChIKey | PIUFWGCIIJHPSK-MKXGPGLRSA-O |
| XLogP | 1.24 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.41 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|