C21H22N4O5 — CID 7461818
methyl (2R)-3-(1H-indol-3-yl)-2-[1-(2,4,6-trioxo-1-prop-2-enyl-1,3-diazinan-5-yl)ethylideneamino]propanoate (PubChem CID 7461818) has the molecular formula C21H22N4O5 and a molecular weight of 410.43 g/mol. Its IUPAC name is methyl (2R)-3-(1H-indol-3-yl)-2-[1-(2,4,6-trioxo-1-prop-2-enyl-1,3-diazinan-5-yl)ethylideneamino]propanoate.
| Compound Name | methyl (2R)-3-(1H-indol-3-yl)-2-[1-(2,4,6-trioxo-1-prop-2-enyl-1,3-diazinan-5-yl)ethylideneamino]propanoate |
|---|---|
| PubChem CID | 7461818 |
| Molecular Formula | C21H22N4O5 |
| Molecular Weight | 410.43 g/mol |
| Exact Mass | 410.16 |
| IUPAC Name | methyl (2R)-3-(1H-indol-3-yl)-2-[1-(2,4,6-trioxo-1-prop-2-enyl-1,3-diazinan-5-yl)ethylideneamino]propanoate |
| SMILES | C=CCN1C(=O)NC(=O)C(/C(C)=N/[C@H](Cc2c[nH]c3ccccc23)C(=O)OC)C1=O |
| InChI | InChI=1S/C21H22N4O5/c1-4-9-25-19(27)17(18(26)24-21(25)29)12(2)23-16(20(28)30-3)10-13-11-22-15-8-6-5-7-14(13)15/h4-8,11,16-17,22H,1,9-10H2,2-3H3,(H,24,26,29)/b23-12+/t16-,17?/m1/s1 |
| InChIKey | KZJMIIJQZDSMOO-HVEYIGAISA-N |
| XLogP | 1.59 |
| TPSA | 120.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.43 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|