C17H13Cl2N3OS2 — CID 7463335
2-(1,3-benzothiazol-2-ylsulfanyl)-N-[(E)-1-(2,4-dichlorophenyl)ethylideneamino]acetamide (PubChem CID 7463335) has the molecular formula C17H13Cl2N3OS2 and a molecular weight of 410.35 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-ylsulfanyl)-N-[(E)-1-(2,4-dichlorophenyl)ethylideneamino]acetamide.
| Compound Name | 2-(1,3-benzothiazol-2-ylsulfanyl)-N-[(E)-1-(2,4-dichlorophenyl)ethylideneamino]acetamide |
|---|---|
| PubChem CID | 7463335 |
| Molecular Formula | C17H13Cl2N3OS2 |
| Molecular Weight | 410.35 g/mol |
| Exact Mass | 408.99 |
| IUPAC Name | 2-(1,3-benzothiazol-2-ylsulfanyl)-N-[(E)-1-(2,4-dichlorophenyl)ethylideneamino]acetamide |
| SMILES | C/C(=N\NC(=O)CSc1nc2ccccc2s1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C17H13Cl2N3OS2/c1-10(12-7-6-11(18)8-13(12)19)21-22-16(23)9-24-17-20-14-4-2-3-5-15(14)25-17/h2-8H,9H2,1H3,(H,22,23)/b21-10+ |
| InChIKey | SUAHVNAEQSUOHB-UFFVCSGVSA-N |
| XLogP | 5.24 |
| TPSA | 54.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.35 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|