C15H17N3OS2 — CID 2878154
2-(1,3-benzothiazol-2-ylsulfanyl)-N-(hex-5-en-2-ylideneamino)acetamide (PubChem CID 2878154) has the molecular formula C15H17N3OS2 and a molecular weight of 319.46 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-ylsulfanyl)-N-(hex-5-en-2-ylideneamino)acetamide.
| Compound Name | 2-(1,3-benzothiazol-2-ylsulfanyl)-N-(hex-5-en-2-ylideneamino)acetamide |
|---|---|
| PubChem CID | 2878154 |
| Molecular Formula | C15H17N3OS2 |
| Molecular Weight | 319.46 g/mol |
| Exact Mass | 319.08 |
| IUPAC Name | 2-(1,3-benzothiazol-2-ylsulfanyl)-N-(hex-5-en-2-ylideneamino)acetamide |
| SMILES | C=CCCC(C)=NNC(=O)CSc1nc2ccccc2s1 |
| InChI | InChI=1S/C15H17N3OS2/c1-3-4-7-11(2)17-18-14(19)10-20-15-16-12-8-5-6-9-13(12)21-15/h3,5-6,8-9H,1,4,7,10H2,2H3,(H,18,19) |
| InChIKey | RJBOKMKZPWNFJA-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 54.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.46 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|