C13H13N3OS3 — CID 10734721
2-(1,3-benzothiazol-2-ylsulfanyl)-N-(prop-2-enylcarbamothioyl)acetamide (PubChem CID 10734721) has the molecular formula C13H13N3OS3 and a molecular weight of 323.47 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-ylsulfanyl)-N-(prop-2-enylcarbamothioyl)acetamide.
| Compound Name | 2-(1,3-benzothiazol-2-ylsulfanyl)-N-(prop-2-enylcarbamothioyl)acetamide |
|---|---|
| PubChem CID | 10734721 |
| Molecular Formula | C13H13N3OS3 |
| Molecular Weight | 323.47 g/mol |
| Exact Mass | 323.02 |
| IUPAC Name | 2-(1,3-benzothiazol-2-ylsulfanyl)-N-(prop-2-enylcarbamothioyl)acetamide |
| SMILES | C=CCNC(=S)NC(=O)CSc1nc2ccccc2s1 |
| InChI | InChI=1S/C13H13N3OS3/c1-2-7-14-12(18)16-11(17)8-19-13-15-9-5-3-4-6-10(9)20-13/h2-6H,1,7-8H2,(H2,14,16,17,18) |
| InChIKey | RPGJNCQDXLVFTG-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.47 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|