C20H23N3O2S2 — CID 3776386
2-(1,3-benzothiazol-2-ylsulfanyl)-N-[[4-methyl-4-(5-methylfuran-2-yl)pentan-2-ylidene]amino]acetamide (PubChem CID 3776386) has the molecular formula C20H23N3O2S2 and a molecular weight of 401.56 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-ylsulfanyl)-N-[[4-methyl-4-(5-methylfuran-2-yl)pentan-2-ylidene]amino]acetamide.
| Compound Name | 2-(1,3-benzothiazol-2-ylsulfanyl)-N-[[4-methyl-4-(5-methylfuran-2-yl)pentan-2-ylidene]amino]acetamide |
|---|---|
| PubChem CID | 3776386 |
| Molecular Formula | C20H23N3O2S2 |
| Molecular Weight | 401.56 g/mol |
| Exact Mass | 401.12 |
| IUPAC Name | 2-(1,3-benzothiazol-2-ylsulfanyl)-N-[[4-methyl-4-(5-methylfuran-2-yl)pentan-2-ylidene]amino]acetamide |
| SMILES | CC(CC(C)(C)c1ccc(C)o1)=NNC(=O)CSc1nc2ccccc2s1 |
| InChI | InChI=1S/C20H23N3O2S2/c1-13(11-20(3,4)17-10-9-14(2)25-17)22-23-18(24)12-26-19-21-15-7-5-6-8-16(15)27-19/h5-10H,11-12H2,1-4H3,(H,23,24) |
| InChIKey | RYUHHQKRPQXCIO-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 67.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.56 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|