C20H22FNO3S2 — CID 7465496
2-(2-fluorophenyl)sulfanylethyl 2-[2-(2,4-dimethylanilino)-2-oxoethyl]sulfanylacetate (PubChem CID 7465496) has the molecular formula C20H22FNO3S2 and a molecular weight of 407.53 g/mol. Its IUPAC name is 2-(2-fluorophenyl)sulfanylethyl 2-[2-(2,4-dimethylanilino)-2-oxoethyl]sulfanylacetate.
| Compound Name | 2-(2-fluorophenyl)sulfanylethyl 2-[2-(2,4-dimethylanilino)-2-oxoethyl]sulfanylacetate |
|---|---|
| PubChem CID | 7465496 |
| Molecular Formula | C20H22FNO3S2 |
| Molecular Weight | 407.53 g/mol |
| Exact Mass | 407.10 |
| IUPAC Name | 2-(2-fluorophenyl)sulfanylethyl 2-[2-(2,4-dimethylanilino)-2-oxoethyl]sulfanylacetate |
| SMILES | Cc1ccc(NC(=O)CSCC(=O)OCCSc2ccccc2F)c(C)c1 |
| InChI | InChI=1S/C20H22FNO3S2/c1-14-7-8-17(15(2)11-14)22-19(23)12-26-13-20(24)25-9-10-27-18-6-4-3-5-16(18)21/h3-8,11H,9-10,12-13H2,1-2H3,(H,22,23) |
| InChIKey | KWWAYBNLTMYKOV-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.53 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|