C19H19FN4O2S2 — CID 7567154
2-(2-fluorophenyl)sulfanylethyl 2-[1-(2,5-dimethylphenyl)tetrazol-5-yl]sulfanylacetate (PubChem CID 7567154) has the molecular formula C19H19FN4O2S2 and a molecular weight of 418.52 g/mol. Its IUPAC name is 2-(2-fluorophenyl)sulfanylethyl 2-[1-(2,5-dimethylphenyl)tetrazol-5-yl]sulfanylacetate.
| Compound Name | 2-(2-fluorophenyl)sulfanylethyl 2-[1-(2,5-dimethylphenyl)tetrazol-5-yl]sulfanylacetate |
|---|---|
| PubChem CID | 7567154 |
| Molecular Formula | C19H19FN4O2S2 |
| Molecular Weight | 418.52 g/mol |
| Exact Mass | 418.09 |
| IUPAC Name | 2-(2-fluorophenyl)sulfanylethyl 2-[1-(2,5-dimethylphenyl)tetrazol-5-yl]sulfanylacetate |
| SMILES | Cc1ccc(C)c(-n2nnnc2SCC(=O)OCCSc2ccccc2F)c1 |
| InChI | InChI=1S/C19H19FN4O2S2/c1-13-7-8-14(2)16(11-13)24-19(21-22-23-24)28-12-18(25)26-9-10-27-17-6-4-3-5-15(17)20/h3-8,11H,9-10,12H2,1-2H3 |
| InChIKey | PQTGQBCGUIUUOM-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 69.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.52 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|