C17H24ClN3O2 — CID 74675316
2-[[amino-(4-chlorophenyl)methylidene]amino]oxy-N-methyl-N-(4-methylcyclohexyl)acetamide (PubChem CID 74675316) has the molecular formula C17H24ClN3O2 and a molecular weight of 337.85 g/mol. Its IUPAC name is 2-[[amino-(4-chlorophenyl)methylidene]amino]oxy-N-methyl-N-(4-methylcyclohexyl)acetamide.
| Compound Name | 2-[[amino-(4-chlorophenyl)methylidene]amino]oxy-N-methyl-N-(4-methylcyclohexyl)acetamide |
|---|---|
| PubChem CID | 74675316 |
| Molecular Formula | C17H24ClN3O2 |
| Molecular Weight | 337.85 g/mol |
| Exact Mass | 337.16 |
| IUPAC Name | 2-[[amino-(4-chlorophenyl)methylidene]amino]oxy-N-methyl-N-(4-methylcyclohexyl)acetamide |
| SMILES | CC1CCC(N(C)C(=O)CON=C(N)c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C17H24ClN3O2/c1-12-3-9-15(10-4-12)21(2)16(22)11-23-20-17(19)13-5-7-14(18)8-6-13/h5-8,12,15H,3-4,9-11H2,1-2H3,(H2,19,20) |
| InChIKey | ZWUXPKMRKRLMDZ-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 67.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.85 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|