C18H16F4N2O3 — CID 7467659
N-(4-methylphenyl)-2-[methyl-[2-(2,3,5,6-tetrafluorophenoxy)acetyl]amino]acetamide (PubChem CID 7467659) has the molecular formula C18H16F4N2O3 and a molecular weight of 384.33 g/mol. Its IUPAC name is N-(4-methylphenyl)-2-[methyl-[2-(2,3,5,6-tetrafluorophenoxy)acetyl]amino]acetamide.
| Compound Name | N-(4-methylphenyl)-2-[methyl-[2-(2,3,5,6-tetrafluorophenoxy)acetyl]amino]acetamide |
|---|---|
| PubChem CID | 7467659 |
| Molecular Formula | C18H16F4N2O3 |
| Molecular Weight | 384.33 g/mol |
| Exact Mass | 384.11 |
| IUPAC Name | N-(4-methylphenyl)-2-[methyl-[2-(2,3,5,6-tetrafluorophenoxy)acetyl]amino]acetamide |
| SMILES | Cc1ccc(NC(=O)CN(C)C(=O)COc2c(F)c(F)cc(F)c2F)cc1 |
| InChI | InChI=1S/C18H16F4N2O3/c1-10-3-5-11(6-4-10)23-14(25)8-24(2)15(26)9-27-18-16(21)12(19)7-13(20)17(18)22/h3-7H,8-9H2,1-2H3,(H,23,25) |
| InChIKey | OVCHXSWYJAMBAC-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.33 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|