C20H22N2O5 — CID 7612189
2-[[2-(5-formyl-2-methoxyphenoxy)acetyl]-methylamino]-N-(4-methylphenyl)acetamide (PubChem CID 7612189) has the molecular formula C20H22N2O5 and a molecular weight of 370.41 g/mol. Its IUPAC name is 2-[[2-(5-formyl-2-methoxyphenoxy)acetyl]-methylamino]-N-(4-methylphenyl)acetamide.
| Compound Name | 2-[[2-(5-formyl-2-methoxyphenoxy)acetyl]-methylamino]-N-(4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 7612189 |
| Molecular Formula | C20H22N2O5 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | 2-[[2-(5-formyl-2-methoxyphenoxy)acetyl]-methylamino]-N-(4-methylphenyl)acetamide |
| SMILES | COc1ccc(C=O)cc1OCC(=O)N(C)CC(=O)Nc1ccc(C)cc1 |
| InChI | InChI=1S/C20H22N2O5/c1-14-4-7-16(8-5-14)21-19(24)11-22(2)20(25)13-27-18-10-15(12-23)6-9-17(18)26-3/h4-10,12H,11,13H2,1-3H3,(H,21,24) |
| InChIKey | HSTQAWWYSFZYQW-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|